| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide |
| MolecularFormula | C14H14N6O5 |
| Smiles | O=C(CCNC(C(N1)=O)=NNC1=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C14H14N6O5/c21-11(3-4-15-12-13(22)17-14(23)20-19-12)18-16-6-8-1-2-9-10(5-8)25-7-24-9/h1-2,5-6H,3-4,7H2,(H,15,19)(H,18,21)(H2,17,20,22,23) |
| InChIK | BDTBGWAPTOLOFI-UHFFFAOYSA-N |
| TotalMolweight | 346.302 |
| Molweight | 346.302 |
| MonoisotopicMass | 346.102569 |
| CLogP | -0.0896 |
| CLogS | -3.917 |
| H Acceptors | 11 |
| H Donors | 4 |
| TotalSurfaceArea | 254.36 |
| Relative PSA | 0.50315 |
| PolarSurfaceArea | 142.51 |
| Druglikeness | 6.8284 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanamide