| MolName | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C25H18N5OBrCl2S |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1-c(cc1)ccc1Cl)N/N=C\C(\Br)=C\c1ccccc1 |
| InChI | InChI=1S/C25H18BrCl2N5OS/c26-19(14-17-4-2-1-3-5-17)15-29-30-23(34)16-35-25-32-31-24(18-6-8-20(27)9-7-18)33(25)22-12-10-21(28)11-13-22/h1-15H,16H2,(H,30,34) |
| InChIK | BEAKXPKPALTENU-UHFFFAOYSA-N |
| TotalMolweight | 587.328 |
| Molweight | 587.328 |
| MonoisotopicMass | 584.979245 |
| CLogP | 6.3547 |
| CLogS | -11.013 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 398.66 |
| Relative PSA | 0.20647 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 0.33331 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]acetamide