| MolName | 3,4-dimethoxy-N-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
| MolecularFormula | C24H24N2O4 |
| Smiles | Cc1ccc(COc2ccc(C=NNC(c(cc3)cc(OC)c3OC)=O)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-17-4-6-19(7-5-17)16-30-21-11-8-18(9-12-21)15-25-26-24(27)20-10-13-22(28-2)23(14-20)29-3/h4-15H,16H2,1-3H3,(H,26,27) |
| InChIK | BECQTJIJCFJVPX-UHFFFAOYSA-N |
| TotalMolweight | 404.465 |
| Molweight | 404.465 |
| MonoisotopicMass | 404.173608 |
| CLogP | 4.7536 |
| CLogS | -5.442 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 327.29 |
| Relative PSA | 0.20169 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 3.9613 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3,4-dimethoxy-N-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide | 2 - 3,4-dimethoxy-N-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]benzamide