| MolName | 4-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C18H15N4OClS |
| Smiles | S=C(NN=C1COc2ccccc2)N1N=C/C(/Cl)=C/c1ccccc1 |
| InChI | InChI=1S/C18H15ClN4OS/c19-15(11-14-7-3-1-4-8-14)12-20-23-17(21-22-18(23)25)13-24-16-9-5-2-6-10-16/h1-12H,13H2,(H,22,25) |
| InChIK | BETBXBZZWDBHFR-UHFFFAOYSA-N |
| TotalMolweight | 370.863 |
| Molweight | 370.863 |
| MonoisotopicMass | 370.065508 |
| CLogP | 3.3751 |
| CLogS | -5.214 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 285.61 |
| Relative PSA | 0.2662 |
| PolarSurfaceArea | 81.31 |
| Druglikeness | 3.6255 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione