| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C21H17N2OCl |
| Smiles | O=C(C(c1ccccc1)c1ccccc1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C21H17ClN2O/c22-19-14-8-7-13-18(19)15-23-24-21(25)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,20H,(H,24,25) |
| InChIK | BEZPXEORTWUKNP-UHFFFAOYSA-N |
| TotalMolweight | 348.832 |
| Molweight | 348.832 |
| MonoisotopicMass | 348.10294 |
| CLogP | 5.3333 |
| CLogS | -5.571 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 274.67 |
| Relative PSA | 0.1311 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.1905 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2,2-diphenylacetamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2,2-diphenylacetamide