| MolName | [2-bromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] 4-bromobenzoate |
| MolecularFormula | C22H13N3O6Br2Cl2 |
| Smiles | [O-][N+](c(cc1/C=N\NC(COc(ccc(Cl)c2)c2Cl)=O)cc(Br)c1OC(c(cc1)ccc1Br)=O)=O |
| InChI | InChI=1S/C22H13Br2Cl2N3O6/c23-14-3-1-12(2-4-14)22(31)35-21-13(7-16(29(32)33)9-17(21)24)10-27-28-20(30)11-34-19-6-5-15(25)8-18(19)26/h1-10H,11H2,(H,28,30) |
| InChIK | BFMAHWUMCULCPE-UHFFFAOYSA-N |
| TotalMolweight | 646.074 |
| Molweight | 646.074 |
| MonoisotopicMass | 642.854813 |
| CLogP | 5.9478 |
| CLogS | -8.571 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 390.03 |
| Relative PSA | 0.25503 |
| PolarSurfaceArea | 122.81 |
| Druglikeness | -2.8167 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-bromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] 4-bromobenzoate | 2 - [2-bromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] 4-bromobenzoate