| MolName | N-[(Z)-(4-nitrophenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide |
| MolecularFormula | C23H19N5O3 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(C(C2)=NNC2(c2ccccc2)c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C23H19N5O3/c29-22(26-24-16-17-11-13-20(14-12-17)28(30)31)21-15-23(27-25-21,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,16,27H,15H2,(H,26,29) |
| InChIK | BFOAYJWMIOUIPW-UHFFFAOYSA-N |
| TotalMolweight | 413.436 |
| Molweight | 413.436 |
| MonoisotopicMass | 413.14879 |
| CLogP | 3.06 |
| CLogS | -5.761 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 315.52 |
| Relative PSA | 0.28334 |
| PolarSurfaceArea | 111.67 |
| Druglikeness | 0.90485 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-nitrophenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide | 2 - N-[(Z)-(4-nitrophenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide