| MolName | 2-hydroxy-N-[(Z)-naphthalen-1-ylmethylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C25H20N2O2 |
| Smiles | OC(C(N/N=C\c1cccc2ccccc12)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O2/c28-24(27-26-18-20-12-9-11-19-10-7-8-17-23(19)20)25(29,21-13-3-1-4-14-21)22-15-5-2-6-16-22/h1-18,29H,(H,27,28) |
| InChIK | BGLVLDPFTLOEFZ-UHFFFAOYSA-N |
| TotalMolweight | 380.446 |
| Molweight | 380.446 |
| MonoisotopicMass | 380.152478 |
| CLogP | 4.6763 |
| CLogS | -6.033 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 298.11 |
| Relative PSA | 0.16474 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 5.4383 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-naphthalen-1-ylmethylideneamino]-2,2-diphenylacetamide | 2 - 2-hydroxy-N-[(Z)-naphthalen-1-ylmethylideneamino]-2,2-diphenylacetamide