4-[(Z)-[4-(9H-fluoren-9-yl)piperazin-1-yl]iminomethyl]benzoic acid
Formula:C25H23N3O2
Mutagenic:high
Tumorigenic:high
Reproductive Effective:none
4-[(Z)-[4-(9H-fluoren-9-yl)piperazin-1-yl]iminomethyl]benzoic acid is a drug-like molecule.
| MolName | 4-[(Z)-[4-(9H-fluoren-9-yl)piperazin-1-yl]iminomethyl]benzoic acid |
| MolecularFormula | C25H23N3O2 |
| Smiles | OC(c1ccc(/C=N\N(CC2)CCN2C2c(cccc3)c3-c3c2cccc3)cc1)=O |
| InChI | InChI=1S/C25H23N3O2/c29-25(30)19-11-9-18(10-12-19)17-26-28-15-13-27(14-16-28)24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-12,17,24H,13-16H2,(H,29,30) |
| InChIK | BGVOSNVQWAJEBO-UHFFFAOYSA-N |
| TotalMolweight | 397.477 |
| Molweight | 397.477 |
| MonoisotopicMass | 397.179027 |
| CLogP | 3.4674 |
| CLogS | -4.929 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 302.78 |
| Relative PSA | 0.1478 |
| PolarSurfaceArea | 56.14 |
| Druglikeness | 6.3615 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 10 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-(9H-fluoren-9-yl)piperazin-1-yl]iminomethyl]benzoic acid | 2 - 4-[(Z)-[4-(9H-fluoren-9-yl)piperazin-1-yl]iminomethyl]benzoic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off