| MolName | N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| MolecularFormula | C25H21N5O4S2 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(CSC(N2c3ccccc3)=Nc(sc3c4CCCC3)c4C2=O)=O)c1)=O |
| InChI | InChI=1S/C25H21N5O4S2/c31-21(28-26-14-16-7-6-10-18(13-16)30(33)34)15-35-25-27-23-22(19-11-4-5-12-20(19)36-23)24(32)29(25)17-8-2-1-3-9-17/h1-3,6-10,13-14H,4-5,11-12,15H2,(H,28,31) |
| InChIK | BGYCRFXUUDIROV-UHFFFAOYSA-N |
| TotalMolweight | 519.605 |
| Molweight | 519.605 |
| MonoisotopicMass | 519.103495 |
| CLogP | 4.5019 |
| CLogS | -7.837 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 376.67 |
| Relative PSA | 0.35145 |
| PolarSurfaceArea | 173.49 |
| Druglikeness | -2.5909 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide | 2 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide