| MolName | 1-[(Z)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-phenoxyphenyl)thiourea |
| MolecularFormula | C25H21N4OClS |
| Smiles | S=C(Nc(cc1)ccc1Oc1ccccc1)N/N=C\c1cccn1Cc(cc1)ccc1Cl |
| InChI | InChI=1S/C25H21ClN4OS/c26-20-10-8-19(9-11-20)18-30-16-4-5-22(30)17-27-29-25(32)28-21-12-14-24(15-13-21)31-23-6-2-1-3-7-23/h1-17H,18H2,(H2,28,29,32) |
| InChIK | BHNIZVWMWLWZQR-UHFFFAOYSA-N |
| TotalMolweight | 460.988 |
| Molweight | 460.988 |
| MonoisotopicMass | 460.112458 |
| CLogP | 5.8606 |
| CLogS | -6.855 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 361.31 |
| Relative PSA | 0.21948 |
| PolarSurfaceArea | 82.67 |
| Druglikeness | 4.6053 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-phenoxyphenyl)thiourea | 2 - 1-[(Z)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-phenoxyphenyl)thiourea