| MolName | N-[(Z)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C18H16N6O4 |
| Smiles | [O-][N+](c1ccc(COc2c(/C=N\NC(Cn3ncnc3)=O)cccc2)cc1)=O |
| InChI | InChI=1S/C18H16N6O4/c25-18(10-23-13-19-12-21-23)22-20-9-15-3-1-2-4-17(15)28-11-14-5-7-16(8-6-14)24(26)27/h1-9,12-13H,10-11H2,(H,22,25) |
| InChIK | BHTZGFYFEDTTNT-UHFFFAOYSA-N |
| TotalMolweight | 380.363 |
| Molweight | 380.363 |
| MonoisotopicMass | 380.123304 |
| CLogP | 1.0613 |
| CLogS | -4.133 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 294.66 |
| Relative PSA | 0.35716 |
| PolarSurfaceArea | 127.22 |
| Druglikeness | 0.98304 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide