| MolName | N-cyclopropyl-N'-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C19H19N3O3 |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1OCc1ccccc1)=O)NC1CC1 |
| InChI | InChI=1S/C19H19N3O3/c23-18(21-16-8-9-16)19(24)22-20-12-14-6-10-17(11-7-14)25-13-15-4-2-1-3-5-15/h1-7,10-12,16H,8-9,13H2,(H,21,23)(H,22,24) |
| InChIK | BJEYUEIEEAXSPS-UHFFFAOYSA-N |
| TotalMolweight | 337.378 |
| Molweight | 337.378 |
| MonoisotopicMass | 337.142642 |
| CLogP | 2.313 |
| CLogS | -4.123 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 266.48 |
| Relative PSA | 0.2646 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 4.2913 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-cyclopropyl-N'-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]oxamide | 2 - N-cyclopropyl-N'-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]oxamide