| MolName | 5-[[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl-(4-fluorophenyl)sulfonylamino]methyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| MolecularFormula | C27H22N6O4ClF7S |
| Smiles | O=C(C1=NOC(CN(CCNc(ncc(C(F)(F)F)c2)c2Cl)S(c(cc2)ccc2F)(=O)=O)C1)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22ClF7N6O4S/c28-22-11-18(27(33,34)35)14-37-24(22)36-9-10-41(46(43,44)21-7-5-19(29)6-8-21)15-20-12-23(40-45-20)25(42)39-38-13-16-1-3-17(4-2-16)26(30,31)32/h1-8,11,13-14,20H,9-10,12,15H2,(H,36,37)(H,39,42)/t20-/m1/s1 |
| InChIK | BJPIGQCNFFVNGY-HXUWFJFHSA-N |
| TotalMolweight | 695.015 |
| Molweight | 695.015 |
| MonoisotopicMass | 694.099997 |
| CLogP | 5.6952 |
| CLogS | -7.045 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 463.55 |
| Relative PSA | 0.24179 |
| PolarSurfaceArea | 133.73 |
| Druglikeness | 1.069 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 19 |
| Electronegative Atoms | 19 |
| StereoCenters | 1 |
| Rotatable Bond | 12 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 9 |
| Symmetricatoms | 9 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 5-[[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl-(4-fluorophenyl)sulfonylamino]methyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide | 2 - 5-[[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl-(4-fluorophenyl)sulfonylamino]methyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide