| MolName | 3-cyclohexyl-4-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C17H19N5O2S |
| Smiles | [O-][N+](c1c(/C=C\C=N/N(C(C2CCCCC2)=NN2)C2=S)cccc1)=O |
| InChI | InChI=1S/C17H19N5O2S/c23-22(24)15-11-5-4-7-13(15)10-6-12-18-21-16(19-20-17(21)25)14-8-2-1-3-9-14/h4-7,10-12,14H,1-3,8-9H2,(H,20,25) |
| InChIK | BKFGYZNDBKPIBJ-UHFFFAOYSA-N |
| TotalMolweight | 357.437 |
| Molweight | 357.437 |
| MonoisotopicMass | 357.125945 |
| CLogP | 2.3173 |
| CLogS | -5.359 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 279.93 |
| Relative PSA | 0.34455 |
| PolarSurfaceArea | 117.9 |
| Druglikeness | -6.2932 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-cyclohexyl-4-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione | 2 - 3-cyclohexyl-4-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione