| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
| MolecularFormula | C24H17N4O2F |
| Smiles | O=C(C1=C(c2ccccc2)C(c2ccccc2)=NNC1=O)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C24H17FN4O2/c25-19-14-8-7-13-18(19)15-26-28-23(30)21-20(16-9-3-1-4-10-16)22(27-29-24(21)31)17-11-5-2-6-12-17/h1-15H,(H,28,30)(H,29,31) |
| InChIK | BKURTCTVDCWSMT-UHFFFAOYSA-N |
| TotalMolweight | 412.423 |
| Molweight | 412.423 |
| MonoisotopicMass | 412.133554 |
| CLogP | 3.715 |
| CLogS | -5.731 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 314.7 |
| Relative PSA | 0.22885 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 4.3229 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide