| MolName | 3-(4-chlorophenyl)sulfonyl-1-[(Z)-pyridin-4-ylmethylideneamino]pyrrolo[3,2-b]quinoxalin-2-amine |
| MolecularFormula | C22H15N6O2ClS |
| Smiles | Nc(n(c1nc2ccccc2nc11)/N=C\c2ccncc2)c1S(c(cc1)ccc1Cl)(=O)=O |
| InChI | InChI=1S/C22H15ClN6O2S/c23-15-5-7-16(8-6-15)32(30,31)20-19-22(28-18-4-2-1-3-17(18)27-19)29(21(20)24)26-13-14-9-11-25-12-10-14/h1-13H,24H2 |
| InChIK | BLEFMGVIGGWUOS-UHFFFAOYSA-N |
| TotalMolweight | 462.92 |
| Molweight | 462.92 |
| MonoisotopicMass | 462.066571 |
| CLogP | 3.3252 |
| CLogS | -8.509 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 324.74 |
| Relative PSA | 0.29297 |
| PolarSurfaceArea | 124.5 |
| Druglikeness | 3.933 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-chlorophenyl)sulfonyl-1-[(Z)-pyridin-4-ylmethylideneamino]pyrrolo[3,2-b]quinoxalin-2-amine | 2 - 3-(4-chlorophenyl)sulfonyl-1-[(Z)-pyridin-4-ylmethylideneamino]pyrrolo[3,2-b]quinoxalin-2-amine