| MolName | 2-(3-bromoanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C15H13N4O3Br |
| Smiles | [O-][N+](c1cccc(/C=N\NC(CNc2cccc(Br)c2)=O)c1)=O |
| InChI | InChI=1S/C15H13BrN4O3/c16-12-4-2-5-13(8-12)17-10-15(21)19-18-9-11-3-1-6-14(7-11)20(22)23/h1-9,17H,10H2,(H,19,21) |
| InChIK | BLMCVPDRWCTLLG-UHFFFAOYSA-N |
| TotalMolweight | 377.197 |
| Molweight | 377.197 |
| MonoisotopicMass | 376.017102 |
| CLogP | 2.2971 |
| CLogS | -4.837 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 254.51 |
| Relative PSA | 0.30604 |
| PolarSurfaceArea | 99.31 |
| Druglikeness | -1.9192 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3-bromoanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide | 2 - 2-(3-bromoanilino)-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide