| MolName | 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C25H24N8O4 |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(NCc3ccccc3)n2)o1)=O |
| InChI | InChI=1S/C25H24N8O4/c34-33(35)20-8-6-19(7-9-20)22-11-10-21(37-22)17-27-31-24-28-23(26-16-18-4-2-1-3-5-18)29-25(30-24)32-12-14-36-15-13-32/h1-11,17H,12-16H2,(H2,26,28,29,30,31) |
| InChIK | BLVWNWPRWFIJHT-UHFFFAOYSA-N |
| TotalMolweight | 500.518 |
| Molweight | 500.518 |
| MonoisotopicMass | 500.192052 |
| CLogP | 4.5027 |
| CLogS | -6.741 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 385.46 |
| Relative PSA | 0.32538 |
| PolarSurfaceArea | 146.52 |
| Druglikeness | 0.28238 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazine-2,4-diamine