| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| MolecularFormula | C32H24N4O3S2 |
| Smiles | O=C(c(cccc1)c1NS(c1cccs1)(=O)=O)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C32H24N4O3S2/c37-32(26-17-7-9-18-28(26)35-41(38,39)30-20-11-21-40-30)34-33-22-27-25-16-8-10-19-29(25)36(24-14-5-2-6-15-24)31(27)23-12-3-1-4-13-23/h1-22,35H,(H,34,37) |
| InChIK | BLWUYKLPNSUNAD-UHFFFAOYSA-N |
| TotalMolweight | 576.7 |
| Molweight | 576.7 |
| MonoisotopicMass | 576.128981 |
| CLogP | 6.7418 |
| CLogS | -10.563 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 426.05 |
| Relative PSA | 0.24241 |
| PolarSurfaceArea | 129.18 |
| Druglikeness | 7.6342 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43902 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 32 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide