| MolName | 5-nitro-N-[(Z)-(4-pyrrolidin-1-ylphenyl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C16H17N5O2 |
| Smiles | [O-][N+](c(cc1)cnc1N/N=C\c(cc1)ccc1N1CCCC1)=O |
| InChI | InChI=1S/C16H17N5O2/c22-21(23)15-7-8-16(17-12-15)19-18-11-13-3-5-14(6-4-13)20-9-1-2-10-20/h3-8,11-12H,1-2,9-10H2,(H,17,19) |
| InChIK | BLXOUVMAPOOTRC-UHFFFAOYSA-N |
| TotalMolweight | 311.344 |
| Molweight | 311.344 |
| MonoisotopicMass | 311.138225 |
| CLogP | 3.7608 |
| CLogS | -4.061 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 243.51 |
| Relative PSA | 0.27888 |
| PolarSurfaceArea | 86.34 |
| Druglikeness | -1.0912 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-nitro-N-[(Z)-(4-pyrrolidin-1-ylphenyl)methylideneamino]pyridin-2-amine | 2 - 5-nitro-N-[(Z)-(4-pyrrolidin-1-ylphenyl)methylideneamino]pyridin-2-amine