| MolName | N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| MolecularFormula | C23H21N3O3 |
| Smiles | Oc1cccc(/C=N\NC(CNC(C(c2ccccc2)c2ccccc2)=O)=O)c1 |
| InChI | InChI=1S/C23H21N3O3/c27-20-13-7-8-17(14-20)15-25-26-21(28)16-24-23(29)22(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-15,22,27H,16H2,(H,24,29)(H,26,28) |
| InChIK | BMDNUNGSIXGMNR-UHFFFAOYSA-N |
| TotalMolweight | 387.438 |
| Molweight | 387.438 |
| MonoisotopicMass | 387.158292 |
| CLogP | 3.4653 |
| CLogS | -4.306 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 308.57 |
| Relative PSA | 0.23855 |
| PolarSurfaceArea | 90.79 |
| Druglikeness | 6.2966 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide | 2 - N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide