| MolName | 2-[2-[(Z)-[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C21H23N4O6BrS |
| Smiles | OC(COc1c(/C=N\NC(CN(CC2)CCN2S(c(cc2)ccc2Br)(=O)=O)=O)cccc1)=O |
| InChI | InChI=1S/C21H23BrN4O6S/c22-17-5-7-18(8-6-17)33(30,31)26-11-9-25(10-12-26)14-20(27)24-23-13-16-3-1-2-4-19(16)32-15-21(28)29/h1-8,13H,9-12,14-15H2,(H,24,27)(H,28,29) |
| InChIK | BMHZOIMEPTWMKE-UHFFFAOYSA-N |
| TotalMolweight | 539.406 |
| Molweight | 539.406 |
| MonoisotopicMass | 538.052167 |
| CLogP | 0.8574 |
| CLogS | -2.818 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 357.96 |
| Relative PSA | 0.30123 |
| PolarSurfaceArea | 136.99 |
| Druglikeness | 7.8122 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid