| MolName | N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-(4-fluorophenyl)butanediamide |
| MolecularFormula | C17H14N3O2Cl2F |
| Smiles | O=C(CCC(N/N=C\c(c(Cl)ccc1)c1Cl)=O)Nc(cc1)ccc1F |
| InChI | InChI=1S/C17H14Cl2FN3O2/c18-14-2-1-3-15(19)13(14)10-21-23-17(25)9-8-16(24)22-12-6-4-11(20)5-7-12/h1-7,10H,8-9H2,(H,22,24)(H,23,25) |
| InChIK | BMHZTFHONFVWOC-UHFFFAOYSA-N |
| TotalMolweight | 382.221 |
| Molweight | 382.221 |
| MonoisotopicMass | 381.044709 |
| CLogP | 4.3655 |
| CLogS | -5.851 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 280.91 |
| Relative PSA | 0.21541 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 2.2812 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-(4-fluorophenyl)butanediamide | 2 - N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-(4-fluorophenyl)butanediamide