| MolName | N-[(Z)-furan-3-ylmethylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C12H10N2O3 |
| Smiles | Oc(cccc1)c1C(N/N=C\c1cocc1)=O |
| InChI | InChI=1S/C12H10N2O3/c15-11-4-2-1-3-10(11)12(16)14-13-7-9-5-6-17-8-9/h1-8,15H,(H,14,16) |
| InChIK | BMOLLHLIWBSAMF-UHFFFAOYSA-N |
| TotalMolweight | 230.222 |
| Molweight | 230.222 |
| MonoisotopicMass | 230.069143 |
| CLogP | 1.9906 |
| CLogS | -3.083 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 183.03 |
| Relative PSA | 0.34541 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 4.136 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-3-ylmethylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-furan-3-ylmethylideneamino]-2-hydroxybenzamide