| MolName | [3-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C22H14N2O5Cl2 |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)N/N=C\c1cc(OC(c(cc2)cc3c2OCO3)=O)ccc1 |
| InChI | InChI=1S/C22H14Cl2N2O5/c23-15-5-6-17(18(24)10-15)21(27)26-25-11-13-2-1-3-16(8-13)31-22(28)14-4-7-19-20(9-14)30-12-29-19/h1-11H,12H2,(H,26,27) |
| InChIK | BMRMZFPSTHPLNF-UHFFFAOYSA-N |
| TotalMolweight | 457.268 |
| Molweight | 457.268 |
| MonoisotopicMass | 456.027977 |
| CLogP | 5.9555 |
| CLogS | -7.374 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 325.6 |
| Relative PSA | 0.24278 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | 4.0013 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [3-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate