| MolName | N-[(E)-[4-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-1,1,2,2-tetrafluorobutoxy]-3,3,4,4-tetrafluorobutylidene]amino]-2,4-dinitroaniline |
| MolecularFormula | C20H14N8O9F8 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C/CC(C(OC(C(C/C=N\Nc(ccc([N+]([O-])=O)c1)c1[N+]([O-])=O)(F)F)(F)F)(F)F)(F)F)=O |
| InChI | InChI=1S/C20H14F8N8O9/c21-17(22,5-7-29-31-13-3-1-11(33(37)38)9-15(13)35(41)42)19(25,26)45-20(27,28)18(23,24)6-8-30-32-14-4-2-12(34(39)40)10-16(14)36(43)44/h1-4,7-10,31-32H,5-6H2 |
| InChIK | BMUDXDBMNGSDHS-UHFFFAOYSA-N |
| TotalMolweight | 662.362 |
| Molweight | 662.362 |
| MonoisotopicMass | 662.075601 |
| CLogP | 5.1629 |
| CLogS | -7.885 |
| H Acceptors | 17 |
| H Donors | 2 |
| TotalSurfaceArea | 430.1 |
| Relative PSA | 0.41297 |
| PolarSurfaceArea | 241.29 |
| Druglikeness | -34.55 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 45 |
| NonCHAtoms | 25 |
| Electronegative Atoms | 25 |
| Rotatable Bond | 16 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| AcidicOxygens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-[4-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-1,1,2,2-tetrafluorobutoxy]-3,3,4,4-tetrafluorobutylidene]amino]-2,4-dinitroaniline | 2 - N-[(E)-[4-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-1,1,2,2-tetrafluorobutoxy]-3,3,4,4-tetrafluorobutylidene]amino]-2,4-dinitroaniline