| MolName | 8-fluoro-3-[(Z)-(4-methoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C18H13N4O3F |
| Smiles | COc1ccc(/C=N\N(C(c([nH]c(cc2)c3cc2F)c3N2)=O)C2=O)cc1 |
| InChI | InChI=1S/C18H13FN4O3/c1-26-12-5-2-10(3-6-12)9-20-23-17(24)16-15(22-18(23)25)13-8-11(19)4-7-14(13)21-16/h2-9,21H,1H3,(H,22,25) |
| InChIK | BNXUQXLTTCWWOG-UHFFFAOYSA-N |
| TotalMolweight | 352.324 |
| Molweight | 352.324 |
| MonoisotopicMass | 352.097169 |
| CLogP | 2.5472 |
| CLogS | -4.979 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 254.32 |
| Relative PSA | 0.30116 |
| PolarSurfaceArea | 86.79 |
| Druglikeness | 3.9283 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 8-fluoro-3-[(Z)-(4-methoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 8-fluoro-3-[(Z)-(4-methoxyphenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione