| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-1H-indole-2-carboxamide |
| MolecularFormula | C16H12N3OF |
| Smiles | O=C(c1cc(cccc2)c2[nH]1)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C16H12FN3O/c17-13-7-3-1-6-12(13)10-18-20-16(21)15-9-11-5-2-4-8-14(11)19-15/h1-10,19H,(H,20,21) |
| InChIK | BOCKYWCQHFYAIQ-UHFFFAOYSA-N |
| TotalMolweight | 281.289 |
| Molweight | 281.289 |
| MonoisotopicMass | 281.09644 |
| CLogP | 3.3958 |
| CLogS | -4.584 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 217.51 |
| Relative PSA | 0.22987 |
| PolarSurfaceArea | 57.25 |
| Druglikeness | 4.2553 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-1H-indole-2-carboxamide | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-1H-indole-2-carboxamide