| MolName | 3-[(2Z)-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]benzoic acid |
| MolecularFormula | C26H18N4O4 |
| Smiles | OC(c1cccc(N/N=C\c2cn(-c3ccccc3)nc2C2=Cc(cccc3)c3OC2=O)c1)=O |
| InChI | InChI=1S/C26H18N4O4/c31-25(32)18-8-6-9-20(13-18)28-27-15-19-16-30(21-10-2-1-3-11-21)29-24(19)22-14-17-7-4-5-12-23(17)34-26(22)33/h1-16,28H,(H,31,32) |
| InChIK | BODZQESEKUAPJO-UHFFFAOYSA-N |
| TotalMolweight | 450.453 |
| Molweight | 450.453 |
| MonoisotopicMass | 450.132806 |
| CLogP | 4.6418 |
| CLogS | -4.632 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 339.78 |
| Relative PSA | 0.26485 |
| PolarSurfaceArea | 105.81 |
| Druglikeness | 4.0571 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(2Z)-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]benzoic acid | 2 - 3-[(2Z)-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]benzoic acid