| MolName | (Z)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C20H14N3O2Cl |
| Smiles | [O-][N+](c(cc(/C=N\N=C(c1ccccc1)c1ccccc1)cc1)c1Cl)=O |
| InChI | InChI=1S/C20H14ClN3O2/c21-18-12-11-15(13-19(18)24(25)26)14-22-23-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIK | BOGUKFCRGQWCDJ-UHFFFAOYSA-N |
| TotalMolweight | 363.803 |
| Molweight | 363.803 |
| MonoisotopicMass | 363.077454 |
| CLogP | 5.6667 |
| CLogS | -7.104 |
| H Acceptors | 5 |
| TotalSurfaceArea | 279.6 |
| Relative PSA | 0.19113 |
| PolarSurfaceArea | 70.54 |
| Druglikeness | -3.5105 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-1,1-diphenylmethanimine