| MolName | 3-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-1-phenylpyrazol-3-yl]chromen-2-one |
| MolecularFormula | C26H17N5O2S |
| Smiles | O=C1Oc(cccc2)c2C=C1c(c(/C=N\Nc1nc(cccc2)c2s1)c1)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H17N5O2S/c32-25-20(14-17-8-4-6-12-22(17)33-25)24-18(16-31(30-24)19-9-2-1-3-10-19)15-27-29-26-28-21-11-5-7-13-23(21)34-26/h1-16H,(H,28,29) |
| InChIK | BOKIROKLRJOYRY-UHFFFAOYSA-N |
| TotalMolweight | 463.52 |
| Molweight | 463.52 |
| MonoisotopicMass | 463.110295 |
| CLogP | 5.9591 |
| CLogS | -5.586 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 344.98 |
| Relative PSA | 0.2759 |
| PolarSurfaceArea | 109.64 |
| Druglikeness | 4.4918 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-1-phenylpyrazol-3-yl]chromen-2-one | 2 - 3-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-1-phenylpyrazol-3-yl]chromen-2-one