| MolName | 1-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea |
| MolecularFormula | C25H18N5OFS |
| Smiles | Fc(cccc1)c1NC(N/N=C\c1cn(-c2ccccc2)nc1-c1cc(cccc2)c2o1)=S |
| InChI | InChI=1S/C25H18FN5OS/c26-20-11-5-6-12-21(20)28-25(33)29-27-15-18-16-31(19-9-2-1-3-10-19)30-24(18)23-14-17-8-4-7-13-22(17)32-23/h1-16H,(H2,28,29,33) |
| InChIK | BORUWPLOKKHMCY-UHFFFAOYSA-N |
| TotalMolweight | 455.516 |
| Molweight | 455.516 |
| MonoisotopicMass | 455.121608 |
| CLogP | 5.1546 |
| CLogS | -6.999 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 351.53 |
| Relative PSA | 0.26848 |
| PolarSurfaceArea | 99.47 |
| Druglikeness | 2.6537 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea | 2 - 1-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(2-fluorophenyl)thiourea