| MolName | [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C29H20N4O5Cl2 |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1OC(c(cc1)ccc1Cl)=O)=O)Nc(cccc1)c1C(Nc(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C29H20Cl2N4O5/c30-20-9-7-19(8-10-20)29(39)40-23-15-5-18(6-16-23)17-32-35-28(38)27(37)34-25-4-2-1-3-24(25)26(36)33-22-13-11-21(31)12-14-22/h1-17H,(H,33,36)(H,34,37)(H,35,38) |
| InChIK | BOXSRYRSHQVKGN-UHFFFAOYSA-N |
| TotalMolweight | 575.407 |
| Molweight | 575.407 |
| MonoisotopicMass | 574.081075 |
| CLogP | 5.9339 |
| CLogS | -7.979 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 423.52 |
| Relative PSA | 0.25512 |
| PolarSurfaceArea | 125.96 |
| Druglikeness | 3.4163 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate