| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-[(4-fluorophenoxy)methyl]triazole-4-carboxamide |
| MolecularFormula | C21H18N9O5F |
| Smiles | NC(COc1ccc(/C=N\NC(c2c(COc(cc3)ccc3F)n(-c3nonc3N)nn2)=O)cc1)=O |
| InChI | InChI=1S/C21H18FN9O5/c22-13-3-7-15(8-4-13)34-10-16-18(26-30-31(16)20-19(24)28-36-29-20)21(33)27-25-9-12-1-5-14(6-2-12)35-11-17(23)32/h1-9H,10-11H2,(H2,23,32)(H2,24,28)(H,27,33) |
| InChIK | BOYHRSQNJVJYAT-UHFFFAOYSA-N |
| TotalMolweight | 495.43 |
| Molweight | 495.43 |
| MonoisotopicMass | 495.141494 |
| CLogP | 1.8605 |
| CLogS | -2.976 |
| H Acceptors | 14 |
| H Donors | 3 |
| TotalSurfaceArea | 369.1 |
| Relative PSA | 0.44554 |
| PolarSurfaceArea | 198.66 |
| Druglikeness | 0.89001 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-[(4-fluorophenoxy)methyl]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-[(4-fluorophenoxy)methyl]triazole-4-carboxamide