4-[(Z)-(3-phenylsulfanylpropanoylhydrazinylidene)methyl]benzoic acid
Formula:C17H16N2O3S
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
4-[(Z)-(3-phenylsulfanylpropanoylhydrazinylidene)methyl]benzoic acid is a drug-like molecule.
| MolName | 4-[(Z)-(3-phenylsulfanylpropanoylhydrazinylidene)methyl]benzoic acid |
| MolecularFormula | C17H16N2O3S |
| Smiles | OC(c1ccc(/C=N\NC(CCSc2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C17H16N2O3S/c20-16(10-11-23-15-4-2-1-3-5-15)19-18-12-13-6-8-14(9-7-13)17(21)22/h1-9,12H,10-11H2,(H,19,20)(H,21,22) |
| InChIK | BPHITZWUTHOCGH-UHFFFAOYSA-N |
| TotalMolweight | 328.391 |
| Molweight | 328.391 |
| MonoisotopicMass | 328.088163 |
| CLogP | 3.3539 |
| CLogS | -4.546 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 256.1 |
| Relative PSA | 0.31097 |
| PolarSurfaceArea | 104.06 |
| Druglikeness | 4.3148 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(3-phenylsulfanylpropanoylhydrazinylidene)methyl]benzoic acid | 2 - 4-[(Z)-(3-phenylsulfanylpropanoylhydrazinylidene)methyl]benzoic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off