| MolName | 1-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]phthalazine-1,4-diamine |
| MolecularFormula | C24H18N6O4 |
| Smiles | C1Oc(cc(/C=N\Nc(c2ccccc22)nnc2N/N=C\c(cc2)cc3c2OCO3)cc2)c2O1 |
| InChI | InChI=1S/C24H18N6O4/c1-2-4-18-17(3-1)23(27-25-11-15-5-7-19-21(9-15)33-13-31-19)29-30-24(18)28-26-12-16-6-8-20-22(10-16)34-14-32-20/h1-12H,13-14H2,(H,27,29)(H,28,30) |
| InChIK | BPNMIZMKXIHORY-UHFFFAOYSA-N |
| TotalMolweight | 454.445 |
| Molweight | 454.445 |
| MonoisotopicMass | 454.138954 |
| CLogP | 8.3124 |
| CLogS | -7.514 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 337.86 |
| Relative PSA | 0.3193 |
| PolarSurfaceArea | 111.48 |
| Druglikeness | 1.9109 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 17 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]phthalazine-1,4-diamine | 2 - 1-N,4-N-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]phthalazine-1,4-diamine