| MolName | [2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]methyl N'-[(Z)-(3-nitrophenyl)methylideneamino]carbamimidothioate |
| MolecularFormula | C19H16N8O4S2 |
| Smiles | N/C(/SCc1csc(N/N=C\c2cc([N+]([O-])=O)ccc2)n1)=N/N=C\c1cc([N+]([O-])=O)ccc1 |
| InChI | InChI=1S/C19H16N8O4S2/c20-18(24-21-9-13-3-1-5-16(7-13)26(28)29)32-11-15-12-33-19(23-15)25-22-10-14-4-2-6-17(8-14)27(30)31/h1-10,12H,11H2,(H2,20,24)(H,23,25) |
| InChIK | BPPMPRMEULRXON-UHFFFAOYSA-N |
| TotalMolweight | 484.52 |
| Molweight | 484.52 |
| MonoisotopicMass | 484.073592 |
| CLogP | 5.4377 |
| CLogS | -7.326 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 358.54 |
| Relative PSA | 0.47671 |
| PolarSurfaceArea | 233.2 |
| Druglikeness | -1.2294 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]methyl N'-[(Z)-(3-nitrophenyl)methylideneamino]carbamimidothioate | 2 - [2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]methyl N'-[(Z)-(3-nitrophenyl)methylideneamino]carbamimidothioate