| MolName | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide |
| MolecularFormula | C29H21N5OS3 |
| Smiles | O=C(c1ccc(CSc2nc(cccc3)c3s2)cc1)N/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C29H21N5OS3/c35-28(21-14-12-20(13-15-21)19-37-29-31-24-9-4-5-10-25(24)38-29)32-30-17-22-18-34(23-7-2-1-3-8-23)33-27(22)26-11-6-16-36-26/h1-18H,19H2,(H,32,35) |
| InChIK | BPUTWWDFMADSSV-UHFFFAOYSA-N |
| TotalMolweight | 551.718 |
| Molweight | 551.718 |
| MonoisotopicMass | 551.09082 |
| CLogP | 6.6074 |
| CLogS | -8.42 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 410.72 |
| Relative PSA | 0.29955 |
| PolarSurfaceArea | 153.95 |
| Druglikeness | 7.2732 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide | 2 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide