| MolName | N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide |
| MolecularFormula | C25H19N4OCl |
| Smiles | O=C(c1cc(-c2ccc(CC3)c4c3cccc24)n[nH]1)N/N=C\C(\Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C25H19ClN4O/c26-19(13-16-5-2-1-3-6-16)15-27-30-25(31)23-14-22(28-29-23)20-12-11-18-10-9-17-7-4-8-21(20)24(17)18/h1-8,11-15H,9-10H2,(H,28,29)(H,30,31) |
| InChIK | BPZZLZYFBUZWJQ-UHFFFAOYSA-N |
| TotalMolweight | 426.906 |
| Molweight | 426.906 |
| MonoisotopicMass | 426.124738 |
| CLogP | 5.0465 |
| CLogS | -7.237 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 323.83 |
| Relative PSA | 0.18828 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 4.4978 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide