| MolName | N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-nitrophenoxy)acetamide |
| MolecularFormula | C16H12N4O8 |
| Smiles | [O-][N+](c1cccc(OCC(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)=O)c1)=O |
| InChI | InChI=1S/C16H12N4O8/c21-16(8-26-12-3-1-2-11(5-12)19(22)23)18-17-7-10-4-14-15(28-9-27-14)6-13(10)20(24)25/h1-7H,8-9H2,(H,18,21) |
| InChIK | BQIVCJMPJLUHPY-UHFFFAOYSA-N |
| TotalMolweight | 388.291 |
| Molweight | 388.291 |
| MonoisotopicMass | 388.065516 |
| CLogP | 1.0447 |
| CLogS | -5.132 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 278.35 |
| Relative PSA | 0.45572 |
| PolarSurfaceArea | 160.79 |
| Druglikeness | -0.97839 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-nitrophenoxy)acetamide | 2 - N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-nitrophenoxy)acetamide