| MolName | [3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C23H25N7O3 |
| Smiles | O=C(c1ccco1)Oc1cc(/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1 |
| InChI | InChI=1S/C23H25N7O3/c31-20(19-9-6-14-32-19)33-18-8-5-7-17(15-18)16-24-28-21-25-22(29-10-1-2-11-29)27-23(26-21)30-12-3-4-13-30/h5-9,14-16H,1-4,10-13H2,(H,25,26,27,28) |
| InChIK | BQLPZBDQGCEZRC-UHFFFAOYSA-N |
| TotalMolweight | 447.498 |
| Molweight | 447.498 |
| MonoisotopicMass | 447.201888 |
| CLogP | 5.8637 |
| CLogS | -5.931 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 346.4 |
| Relative PSA | 0.28906 |
| PolarSurfaceArea | 108.98 |
| Druglikeness | 3.8375 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 9 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate