| MolName | 4-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C14H9N5BrFS |
| Smiles | Fc(cc1)c(/C=N\N(C(c2cnccc2)=NN2)C2=S)cc1Br |
| InChI | InChI=1S/C14H9BrFN5S/c15-11-3-4-12(16)10(6-11)8-18-21-13(19-20-14(21)22)9-2-1-5-17-7-9/h1-8H,(H,20,22) |
| InChIK | BQPKATGPPCBGEZ-UHFFFAOYSA-N |
| TotalMolweight | 378.228 |
| Molweight | 378.228 |
| MonoisotopicMass | 376.974604 |
| CLogP | 3.1201 |
| CLogS | -4.804 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 245.46 |
| Relative PSA | 0.3137 |
| PolarSurfaceArea | 84.97 |
| Druglikeness | 0.46147 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione