| MolName | 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C13H11N6O5 |
| Smiles | [O-]C(c1ccc(/C=N\NC(CNC(C(N2)=O)=NNC2=O)=O)cc1)=O |
| InChI | InChI=1S/C13H12N6O5/c20-9(6-14-10-11(21)16-13(24)19-18-10)17-15-5-7-1-3-8(4-2-7)12(22)23/h1-5H,6H2,(H,14,18)(H,17,20)(H,22,23)(H2,16,19,21,24)/p-1 |
| InChIK | BQXYGFYDLXYMHU-UHFFFAOYSA-M |
| TotalMolweight | 331.267 |
| Molweight | 331.267 |
| MonoisotopicMass | 331.079094 |
| CLogP | -3.2463 |
| CLogS | -2.949 |
| H Acceptors | 11 |
| H Donors | 4 |
| TotalSurfaceArea | 245.62 |
| Relative PSA | 0.55085 |
| PolarSurfaceArea | 164.18 |
| Druglikeness | 6.8715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetyl]hydrazinylidene]methyl]benzoate