| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide |
| MolecularFormula | C22H14N5O3F3S |
| Smiles | O=C(c1csc(-n2nc(C(F)(F)F)cc2-c2ccccc2)n1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C22H14F3N5O3S/c23-22(24,25)19-9-16(14-4-2-1-3-5-14)30(29-19)21-27-15(11-34-21)20(31)28-26-10-13-6-7-17-18(8-13)33-12-32-17/h1-11H,12H2,(H,28,31) |
| InChIK | BRDVDVROXHOSHD-UHFFFAOYSA-N |
| TotalMolweight | 485.445 |
| Molweight | 485.445 |
| MonoisotopicMass | 485.076944 |
| CLogP | 4.8647 |
| CLogS | -5.693 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 338.89 |
| Relative PSA | 0.31037 |
| PolarSurfaceArea | 118.87 |
| Druglikeness | -4.39 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide