| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| MolecularFormula | C16H14N3O3BrS |
| Smiles | [O-][N+](c1ccc(CSCC(N/N=C\c(cc2)ccc2Br)=O)cc1)=O |
| InChI | InChI=1S/C16H14BrN3O3S/c17-14-5-1-12(2-6-14)9-18-19-16(21)11-24-10-13-3-7-15(8-4-13)20(22)23/h1-9H,10-11H2,(H,19,21) |
| InChIK | BRLZNPPGZFAQFS-UHFFFAOYSA-N |
| TotalMolweight | 408.275 |
| Molweight | 408.275 |
| MonoisotopicMass | 406.993923 |
| CLogP | 3.1948 |
| CLogS | -5.801 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 274.3 |
| Relative PSA | 0.30594 |
| PolarSurfaceArea | 112.58 |
| Druglikeness | -2.254 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide