| MolName | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide |
| MolecularFormula | C14H9N6O4Br |
| Smiles | [O-][N+](c(cc1)cc(Br)c1-c1ccc(/C=N\NC(c2ncn[nH]2)=O)o1)=O |
| InChI | InChI=1S/C14H9BrN6O4/c15-11-5-8(21(23)24)1-3-10(11)12-4-2-9(25-12)6-17-20-14(22)13-16-7-18-19-13/h1-7H,(H,20,22)(H,16,18,19) |
| InChIK | BRNQYQYZZCTOTC-UHFFFAOYSA-N |
| TotalMolweight | 405.167 |
| Molweight | 405.167 |
| MonoisotopicMass | 403.986865 |
| CLogP | 1.6035 |
| CLogS | -4.709 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 265.83 |
| Relative PSA | 0.43814 |
| PolarSurfaceArea | 141.99 |
| Druglikeness | 0.97717 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide | 2 - N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide