| MolName | N-[(Z)-furan-2-ylmethylideneamino]-4-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide |
| MolecularFormula | C19H16N4O5 |
| Smiles | O=C(COc(cc1)ccc1C(N/N=C\c1ccco1)=O)N/N=C\c1ccco1 |
| InChI | InChI=1S/C19H16N4O5/c24-18(22-20-11-16-3-1-9-26-16)13-28-15-7-5-14(6-8-15)19(25)23-21-12-17-4-2-10-27-17/h1-12H,13H2,(H,22,24)(H,23,25) |
| InChIK | BRWDDRSVTNDNHU-UHFFFAOYSA-N |
| TotalMolweight | 380.359 |
| Molweight | 380.359 |
| MonoisotopicMass | 380.112071 |
| CLogP | 2.6959 |
| CLogS | -4.97 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 303.86 |
| Relative PSA | 0.3628 |
| PolarSurfaceArea | 118.43 |
| Druglikeness | 4.1444 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-4-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-4-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethoxy]benzamide