| MolName | 4-[(Z)-[[1-(4-chlorobenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C21H20N3O4Cl |
| Smiles | OC(c1ccc(/C=N\NC(C(CC2)CCN2C(c(cc2)ccc2Cl)=O)=O)cc1)=O |
| InChI | InChI=1S/C21H20ClN3O4/c22-18-7-5-16(6-8-18)20(27)25-11-9-15(10-12-25)19(26)24-23-13-14-1-3-17(4-2-14)21(28)29/h1-8,13,15H,9-12H2,(H,24,26)(H,28,29) |
| InChIK | BRXHDYPORNVRAK-UHFFFAOYSA-N |
| TotalMolweight | 413.86 |
| Molweight | 413.86 |
| MonoisotopicMass | 413.114234 |
| CLogP | 3.6389 |
| CLogS | -4.691 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 308.6 |
| Relative PSA | 0.25515 |
| PolarSurfaceArea | 99.07 |
| Druglikeness | 7.4387 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[1-(4-chlorobenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[[1-(4-chlorobenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoic acid