| MolName | 3-morpholin-4-ylsulfonyl-N-[(Z)-naphthalen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C22H21N3O4S |
| Smiles | O=C(c1cccc(S(N2CCOCC2)(=O)=O)c1)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C22H21N3O4S/c26-22(24-23-16-17-8-9-18-4-1-2-5-19(18)14-17)20-6-3-7-21(15-20)30(27,28)25-10-12-29-13-11-25/h1-9,14-16H,10-13H2,(H,24,26) |
| InChIK | BSGKYCZJEKMNHD-UHFFFAOYSA-N |
| TotalMolweight | 423.492 |
| Molweight | 423.492 |
| MonoisotopicMass | 423.125277 |
| CLogP | 3.4388 |
| CLogS | -4.533 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 312.01 |
| Relative PSA | 0.25044 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | -2.1628 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-morpholin-4-ylsulfonyl-N-[(Z)-naphthalen-2-ylmethylideneamino]benzamide | 2 - 3-morpholin-4-ylsulfonyl-N-[(Z)-naphthalen-2-ylmethylideneamino]benzamide